C22H24N5O3+ — CID 11909926
(4aR)-8-amino-3-benzylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione (PubChem CID 11909926) has the molecular formula C22H24N5O3+ and a molecular weight of 406.47 g/mol. Its IUPAC name is (4aR)-8-amino-3-benzylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione.
| Compound Name | (4aR)-8-amino-3-benzylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione |
|---|---|
| PubChem CID | 11909926 |
| Molecular Formula | C22H24N5O3+ |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (4aR)-8-amino-3-benzylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione |
| SMILES | Nc1ccc2c(c1)CC1(C(=O)NC(=O)NC1=O)[C@@H]1C[NH+](Cc3ccccc3)CCN21 |
| InChI | InChI=1S/C22H23N5O3/c23-16-6-7-17-15(10-16)11-22(19(28)24-21(30)25-20(22)29)18-13-26(8-9-27(17)18)12-14-4-2-1-3-5-14/h1-7,10,18H,8-9,11-13,23H2,(H2,24,25,28,29,30)/p+1/t18-/m0/s1 |
| InChIKey | UMTNOJPWHMLXBA-SFHVURJKSA-O |
| XLogP | -0.55 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|