C15H19N5O3 — CID 119099765
N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]-2-(6-oxopyridazin-1-yl)acetamide (PubChem CID 119099765) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]-2-(6-oxopyridazin-1-yl)acetamide.
| Compound Name | N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]-2-(6-oxopyridazin-1-yl)acetamide |
|---|---|
| PubChem CID | 119099765 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]-2-(6-oxopyridazin-1-yl)acetamide |
| SMILES | O=C(Cn1ncccc1=O)Nc1cnn(CC2CCCCO2)c1 |
| InChI | InChI=1S/C15H19N5O3/c21-14(11-20-15(22)5-3-6-16-20)18-12-8-17-19(9-12)10-13-4-1-2-7-23-13/h3,5-6,8-9,13H,1-2,4,7,10-11H2,(H,18,21) |
| InChIKey | HCADQXOSHWBBMO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |