C16H19N3O4 — CID 119100091
2-(2-methoxyethoxy)-N-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)pyridine-4-carboxamide (PubChem CID 119100091) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)pyridine-4-carboxamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 119100091 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)pyridine-4-carboxamide |
| SMILES | COCCOc1cc(C(=O)Nc2onc3c2CCCC3)ccn1 |
| InChI | InChI=1S/C16H19N3O4/c1-21-8-9-22-14-10-11(6-7-17-14)15(20)18-16-12-4-2-3-5-13(12)19-23-16/h6-7,10H,2-5,8-9H2,1H3,(H,18,20) |
| InChIKey | KMUGDMQQTWMUGK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|