C17H23FN4O5S — CID 119100497
1-[2-[3-(6-ethyl-5-fluoropyrimidin-4-yl)oxypyrrolidin-1-yl]sulfonylethyl]piperidine-2,6-dione (PubChem CID 119100497) has the molecular formula C17H23FN4O5S and a molecular weight of 414.46 g/mol. Its IUPAC name is 1-[2-[3-(6-ethyl-5-fluoropyrimidin-4-yl)oxypyrrolidin-1-yl]sulfonylethyl]piperidine-2,6-dione.
| Compound Name | 1-[2-[3-(6-ethyl-5-fluoropyrimidin-4-yl)oxypyrrolidin-1-yl]sulfonylethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 119100497 |
| Molecular Formula | C17H23FN4O5S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-[2-[3-(6-ethyl-5-fluoropyrimidin-4-yl)oxypyrrolidin-1-yl]sulfonylethyl]piperidine-2,6-dione |
| SMILES | CCc1ncnc(OC2CCN(S(=O)(=O)CCN3C(=O)CCCC3=O)C2)c1F |
| InChI | InChI=1S/C17H23FN4O5S/c1-2-13-16(18)17(20-11-19-13)27-12-6-7-21(10-12)28(25,26)9-8-22-14(23)4-3-5-15(22)24/h11-12H,2-10H2,1H3 |
| InChIKey | RMWLOMNNACKYAS-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|