About 2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one
2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one (PubChem CID 119101616) has the molecular formula C11H12F3N3O3
and a molecular weight of 291.23 g/mol. Its IUPAC name is 2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one |
| PubChem CID | 119101616 |
| Molecular Formula | C11H12F3N3O3 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one |
| SMILES | Cn1nc(C(=O)N2CC(OCC(F)(F)F)C2)ccc1=O |
| InChI | InChI=1S/C11H12F3N3O3/c1-16-9(18)3-2-8(15-16)10(19)17-4-7(5-17)20-6-11(12,13)14/h2-3,7H,4-6H2,1H3 |
| InChIKey | HVDCGUMXMDPLNE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one?
The IUPAC name of 2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one (CID 119101616) is 2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one.
What is the SMILES notation for 2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one?
The canonical SMILES for 2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one is Cn1nc(C(=O)N2CC(OCC(F)(F)F)C2)ccc1=O.
What is the InChIKey of 2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one?
The InChIKey is HVDCGUMXMDPLNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3N3O3/c1-16-9(18)3-2-8(15-16)10(19)17-4-7(5-17)20-6-11(12,13)14/h2-3,7H,4-6H2,1H3.
What are the key properties of 2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one?
2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one has a molecular weight of 291.23 g/mol, XLogP of 0.18, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-[3-(2,2,2-trifluoroethoxy)azetidine-1-carbonyl]pyridazin-3-one is sourced from PubChem (CID 119101616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).