C17H17N3OS — CID 119102947
N-[2-(4-phenylpyrazol-1-yl)ethyl]-2-thiophen-2-ylacetamide (PubChem CID 119102947) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is N-[2-(4-phenylpyrazol-1-yl)ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-(4-phenylpyrazol-1-yl)ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 119102947 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-[2-(4-phenylpyrazol-1-yl)ethyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NCCn1cc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C17H17N3OS/c21-17(11-16-7-4-10-22-16)18-8-9-20-13-15(12-19-20)14-5-2-1-3-6-14/h1-7,10,12-13H,8-9,11H2,(H,18,21) |
| InChIKey | DMQDJWOWVKJVJI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |