About 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide
2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide (PubChem CID 119104706) has the molecular formula C14H16ClF2NO
and a molecular weight of 287.74 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide |
| PubChem CID | 119104706 |
| Molecular Formula | C14H16ClF2NO |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide |
| SMILES | O=C(Cc1ccccc1Cl)NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H16ClF2NO/c15-12-4-2-1-3-10(12)9-13(19)18-11-5-7-14(16,17)8-6-11/h1-4,11H,5-9H2,(H,18,19) |
| InChIKey | RSYWDYNSOWNMOP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide?
The IUPAC name of 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide (CID 119104706) is 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide.
What is the SMILES notation for 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide?
The canonical SMILES for 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide is O=C(Cc1ccccc1Cl)NC1CCC(F)(F)CC1.
What is the InChIKey of 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide?
The InChIKey is RSYWDYNSOWNMOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClF2NO/c15-12-4-2-1-3-10(12)9-13(19)18-11-5-7-14(16,17)8-6-11/h1-4,11H,5-9H2,(H,18,19).
What are the key properties of 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide?
2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide has a molecular weight of 287.74 g/mol, XLogP of 3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)acetamide is sourced from PubChem (CID 119104706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).