C11H15F2N3O3S2 — CID 119104734
N-[5-[(4,4-difluorocyclohexyl)sulfamoyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 119104734) has the molecular formula C11H15F2N3O3S2 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-[5-[(4,4-difluorocyclohexyl)sulfamoyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[(4,4-difluorocyclohexyl)sulfamoyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 119104734 |
| Molecular Formula | C11H15F2N3O3S2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | N-[5-[(4,4-difluorocyclohexyl)sulfamoyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(S(=O)(=O)NC2CCC(F)(F)CC2)s1 |
| InChI | InChI=1S/C11H15F2N3O3S2/c1-7(17)15-10-14-6-9(20-10)21(18,19)16-8-2-4-11(12,13)5-3-8/h6,8,16H,2-5H2,1H3,(H,14,15,17) |
| InChIKey | HWYIQBLFWTYFNR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |