C22H25NO2 — CID 119105515
1-[3-(cyclopropylmethoxy)pyrrolidin-1-yl]-2,2-diphenylethanone (PubChem CID 119105515) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)pyrrolidin-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[3-(cyclopropylmethoxy)pyrrolidin-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 119105515 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)pyrrolidin-1-yl]-2,2-diphenylethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCC(OCC2CC2)C1 |
| InChI | InChI=1S/C22H25NO2/c24-22(23-14-13-20(15-23)25-16-17-11-12-17)21(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-10,17,20-21H,11-16H2 |
| InChIKey | RGUHJFZPCAREKE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |