C20H22ClN3O5 — CID 11910565
3-[(1S,3S,3aR,6aS)-5-[(2S)-butan-2-yl]-5'-chloro-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-1-yl]propanoate (PubChem CID 11910565) has the molecular formula C20H22ClN3O5 and a molecular weight of 419.87 g/mol. Its IUPAC name is 3-[(1S,3S,3aR,6aS)-5-[(2S)-butan-2-yl]-5'-chloro-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-1-yl]propanoate.
| Compound Name | 3-[(1S,3S,3aR,6aS)-5-[(2S)-butan-2-yl]-5'-chloro-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-1-yl]propanoate |
|---|---|
| PubChem CID | 11910565 |
| Molecular Formula | C20H22ClN3O5 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3-[(1S,3S,3aR,6aS)-5-[(2S)-butan-2-yl]-5'-chloro-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-1-yl]propanoate |
| SMILES | CC[C@H](C)N1C(=O)[C@@H]2[C@H](CCC(=O)[O-])[NH2+][C@@]3(C(=O)Nc4ccc(Cl)cc43)[C@@H]2C1=O |
| InChI | InChI=1S/C20H22ClN3O5/c1-3-9(2)24-17(27)15-13(6-7-14(25)26)23-20(16(15)18(24)28)11-8-10(21)4-5-12(11)22-19(20)29/h4-5,8-9,13,15-16,23H,3,6-7H2,1-2H3,(H,22,29)(H,25,26)/t9-,13-,15+,16-,20+/m0/s1 |
| InChIKey | SUUCXYAJPPITLV-FHCKRJPBSA-N |
| XLogP | -0.64 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|