About (5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride
(5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride (PubChem CID 119106305) has the molecular formula C8H9ClN2OS
and a molecular weight of 216.69 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride |
| PubChem CID | 119106305 |
| Molecular Formula | C8H9ClN2OS |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | (5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride |
| SMILES | Cl.NCc1ncc(-c2cccs2)o1 |
| InChI | InChI=1S/C8H8N2OS.ClH/c9-4-8-10-5-6(11-8)7-2-1-3-12-7;/h1-3,5H,4,9H2;1H |
| InChIKey | URCKBROPRBSFJH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride?
The IUPAC name of (5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride (CID 119106305) is (5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride.
What is the SMILES notation for (5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride?
The canonical SMILES for (5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride is Cl.NCc1ncc(-c2cccs2)o1.
What is the InChIKey of (5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride?
The InChIKey is URCKBROPRBSFJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2OS.ClH/c9-4-8-10-5-6(11-8)7-2-1-3-12-7;/h1-3,5H,4,9H2;1H.
What are the key properties of (5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride?
(5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride has a molecular weight of 216.69 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-thiophen-2-yl-1,3-oxazol-2-yl)methanamine;hydrochloride is sourced from PubChem (CID 119106305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).