C8H13Cl2F3N4 — CID 119106377
[7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methanamine;dihydrochloride (PubChem CID 119106377) has the molecular formula C8H13Cl2F3N4 and a molecular weight of 293.12 g/mol. Its IUPAC name is [7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methanamine;dihydrochloride.
| Compound Name | [7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 119106377 |
| Molecular Formula | C8H13Cl2F3N4 |
| Molecular Weight | 293.12 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | [7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCc1nnc2n1CCC(C(F)(F)F)C2 |
| InChI | InChI=1S/C8H11F3N4.2ClH/c9-8(10,11)5-1-2-15-6(3-5)13-14-7(15)4-12;;/h5H,1-4,12H2;2*1H |
| InChIKey | VGEJLQFXTVVVIX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.12 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |