C20H29N5O — CID 119107208
2-[(5-methyl-1H-pyrazol-4-yl)methylamino]-N-(3-pyrrolidin-1-ylphenyl)pentanamide (PubChem CID 119107208) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 2-[(5-methyl-1H-pyrazol-4-yl)methylamino]-N-(3-pyrrolidin-1-ylphenyl)pentanamide.
| Compound Name | 2-[(5-methyl-1H-pyrazol-4-yl)methylamino]-N-(3-pyrrolidin-1-ylphenyl)pentanamide |
|---|---|
| PubChem CID | 119107208 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 2-[(5-methyl-1H-pyrazol-4-yl)methylamino]-N-(3-pyrrolidin-1-ylphenyl)pentanamide |
| SMILES | CCCC(NCc1cn[nH]c1C)C(=O)Nc1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C20H29N5O/c1-3-7-19(21-13-16-14-22-24-15(16)2)20(26)23-17-8-6-9-18(12-17)25-10-4-5-11-25/h6,8-9,12,14,19,21H,3-5,7,10-11,13H2,1-2H3,(H,22,24)(H,23,26) |
| InChIKey | PXZVVAPVFXZCLF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |