C23H31N3O3 — CID 119107334
3-[(3,5-dimethoxyphenyl)methylamino]-N-(3-pyrrolidin-1-ylphenyl)butanamide (PubChem CID 119107334) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-[(3,5-dimethoxyphenyl)methylamino]-N-(3-pyrrolidin-1-ylphenyl)butanamide.
| Compound Name | 3-[(3,5-dimethoxyphenyl)methylamino]-N-(3-pyrrolidin-1-ylphenyl)butanamide |
|---|---|
| PubChem CID | 119107334 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 3-[(3,5-dimethoxyphenyl)methylamino]-N-(3-pyrrolidin-1-ylphenyl)butanamide |
| SMILES | COc1cc(CNC(C)CC(=O)Nc2cccc(N3CCCC3)c2)cc(OC)c1 |
| InChI | InChI=1S/C23H31N3O3/c1-17(24-16-18-12-21(28-2)15-22(13-18)29-3)11-23(27)25-19-7-6-8-20(14-19)26-9-4-5-10-26/h6-8,12-15,17,24H,4-5,9-11,16H2,1-3H3,(H,25,27) |
| InChIKey | YTXCFTSETUAJNS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |