C20H24ClN4O4+ — CID 11910796
3-[(1S,3R,3aR,6aS)-5-tert-butyl-5'-chloro-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-1-yl]propanamide (PubChem CID 11910796) has the molecular formula C20H24ClN4O4+ and a molecular weight of 419.89 g/mol. Its IUPAC name is 3-[(1S,3R,3aR,6aS)-5-tert-butyl-5'-chloro-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-1-yl]propanamide.
| Compound Name | 3-[(1S,3R,3aR,6aS)-5-tert-butyl-5'-chloro-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-1-yl]propanamide |
|---|---|
| PubChem CID | 11910796 |
| Molecular Formula | C20H24ClN4O4+ |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3-[(1S,3R,3aR,6aS)-5-tert-butyl-5'-chloro-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-1-yl]propanamide |
| SMILES | CC(C)(C)N1C(=O)[C@@H]2[C@H](CCC(N)=O)[NH2+][C@]3(C(=O)Nc4ccc(Cl)cc43)[C@@H]2C1=O |
| InChI | InChI=1S/C20H23ClN4O4/c1-19(2,3)25-16(27)14-12(6-7-13(22)26)24-20(15(14)17(25)28)10-8-9(21)4-5-11(10)23-18(20)29/h4-5,8,12,14-15,24H,6-7H2,1-3H3,(H2,22,26)(H,23,29)/p+1/t12-,14+,15-,20-/m0/s1 |
| InChIKey | MUSLHQQFYBCSJC-IRHLFGLPSA-O |
| XLogP | 0.10 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|