C16H20BrF3N2O — CID 119108038
N-[(6-bromo-2H-chromen-3-yl)methyl]-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine (PubChem CID 119108038) has the molecular formula C16H20BrF3N2O and a molecular weight of 393.25 g/mol. Its IUPAC name is N-[(6-bromo-2H-chromen-3-yl)methyl]-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine.
| Compound Name | N-[(6-bromo-2H-chromen-3-yl)methyl]-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 119108038 |
| Molecular Formula | C16H20BrF3N2O |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | N-[(6-bromo-2H-chromen-3-yl)methyl]-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine |
| SMILES | CN(CCCNCC1=Cc2cc(Br)ccc2OC1)CC(F)(F)F |
| InChI | InChI=1S/C16H20BrF3N2O/c1-22(11-16(18,19)20)6-2-5-21-9-12-7-13-8-14(17)3-4-15(13)23-10-12/h3-4,7-8,21H,2,5-6,9-11H2,1H3 |
| InChIKey | XROJYVUFMOTSSL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|