C18H20N4O2S — CID 119108348
3-imidazol-1-yl-2-methyl-N-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]propan-1-amine (PubChem CID 119108348) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 3-imidazol-1-yl-2-methyl-N-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]propan-1-amine.
| Compound Name | 3-imidazol-1-yl-2-methyl-N-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 119108348 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 3-imidazol-1-yl-2-methyl-N-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]propan-1-amine |
| SMILES | CC(CNCc1ccc(-c2ccccc2[N+](=O)[O-])s1)Cn1ccnc1 |
| InChI | InChI=1S/C18H20N4O2S/c1-14(12-21-9-8-19-13-21)10-20-11-15-6-7-18(25-15)16-4-2-3-5-17(16)22(23)24/h2-9,13-14,20H,10-12H2,1H3 |
| InChIKey | FXSFQJGHHAAYAX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|