C19H24N2OS — CID 119108888
4-[3-[[1-(2,5-dimethylthiophen-3-yl)ethylamino]methyl]phenoxy]butanenitrile (PubChem CID 119108888) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is 4-[3-[[1-(2,5-dimethylthiophen-3-yl)ethylamino]methyl]phenoxy]butanenitrile.
| Compound Name | 4-[3-[[1-(2,5-dimethylthiophen-3-yl)ethylamino]methyl]phenoxy]butanenitrile |
|---|---|
| PubChem CID | 119108888 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 4-[3-[[1-(2,5-dimethylthiophen-3-yl)ethylamino]methyl]phenoxy]butanenitrile |
| SMILES | Cc1cc(C(C)NCc2cccc(OCCCC#N)c2)c(C)s1 |
| InChI | InChI=1S/C19H24N2OS/c1-14-11-19(16(3)23-14)15(2)21-13-17-7-6-8-18(12-17)22-10-5-4-9-20/h6-8,11-12,15,21H,4-5,10,13H2,1-3H3 |
| InChIKey | TZDAZDKJAZUTCH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|