C19H29N3O — CID 119108974
4-[3-[[2-(2-methylpiperidin-1-yl)ethylamino]methyl]phenoxy]butanenitrile (PubChem CID 119108974) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 4-[3-[[2-(2-methylpiperidin-1-yl)ethylamino]methyl]phenoxy]butanenitrile.
| Compound Name | 4-[3-[[2-(2-methylpiperidin-1-yl)ethylamino]methyl]phenoxy]butanenitrile |
|---|---|
| PubChem CID | 119108974 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 4-[3-[[2-(2-methylpiperidin-1-yl)ethylamino]methyl]phenoxy]butanenitrile |
| SMILES | CC1CCCCN1CCNCc1cccc(OCCCC#N)c1 |
| InChI | InChI=1S/C19H29N3O/c1-17-7-2-4-12-22(17)13-11-21-16-18-8-6-9-19(15-18)23-14-5-3-10-20/h6,8-9,15,17,21H,2-5,7,11-14,16H2,1H3 |
| InChIKey | ZTZAMFSVUPUSMO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|