C22H27N5 — CID 119110021
1-[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]-N-(1H-pyrazol-5-ylmethyl)methanamine (PubChem CID 119110021) has the molecular formula C22H27N5 and a molecular weight of 361.49 g/mol. Its IUPAC name is 1-[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]-N-(1H-pyrazol-5-ylmethyl)methanamine.
| Compound Name | 1-[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]-N-(1H-pyrazol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 119110021 |
| Molecular Formula | C22H27N5 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 1-[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]-N-(1H-pyrazol-5-ylmethyl)methanamine |
| SMILES | c1ccc(N2CCN(Cc3ccccc3CNCc3ccn[nH]3)CC2)cc1 |
| InChI | InChI=1S/C22H27N5/c1-2-8-22(9-3-1)27-14-12-26(13-15-27)18-20-7-5-4-6-19(20)16-23-17-21-10-11-24-25-21/h1-11,23H,12-18H2,(H,24,25) |
| InChIKey | MPFKMJIWWDLEBE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |