About 1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine
1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine (PubChem CID 119111154) has the molecular formula C19H28N4
and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine.
Molecular Properties
| Compound Name | 1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine |
| PubChem CID | 119111154 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine |
| SMILES | CC1CC(C)CN(Cc2ccc(CNCc3ncc[nH]3)cc2)C1 |
| InChI | InChI=1S/C19H28N4/c1-15-9-16(2)13-23(12-15)14-18-5-3-17(4-6-18)10-20-11-19-21-7-8-22-19/h3-8,15-16,20H,9-14H2,1-2H3,(H,21,22) |
| InChIKey | BTINKITTWKVMDP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine?
The IUPAC name of 1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine (CID 119111154) is 1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine.
What is the SMILES notation for 1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine?
The canonical SMILES for 1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine is CC1CC(C)CN(Cc2ccc(CNCc3ncc[nH]3)cc2)C1.
What is the InChIKey of 1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine?
The InChIKey is BTINKITTWKVMDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4/c1-15-9-16(2)13-23(12-15)14-18-5-3-17(4-6-18)10-20-11-19-21-7-8-22-19/h3-8,15-16,20H,9-14H2,1-2H3,(H,21,22).
What are the key properties of 1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine?
1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine has a molecular weight of 312.46 g/mol, XLogP of 3.18, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine is sourced from PubChem (CID 119111154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).