C12H21F3N4O3S — CID 119111397
N-[3-[[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]methylamino]propyl]methanesulfonamide (PubChem CID 119111397) has the molecular formula C12H21F3N4O3S and a molecular weight of 358.39 g/mol. Its IUPAC name is N-[3-[[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]methylamino]propyl]methanesulfonamide.
| Compound Name | N-[3-[[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]methylamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 119111397 |
| Molecular Formula | C12H21F3N4O3S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[3-[[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]methylamino]propyl]methanesulfonamide |
| SMILES | Cc1nn(C)c(OCC(F)(F)F)c1CNCCCNS(C)(=O)=O |
| InChI | InChI=1S/C12H21F3N4O3S/c1-9-10(7-16-5-4-6-17-23(3,20)21)11(19(2)18-9)22-8-12(13,14)15/h16-17H,4-8H2,1-3H3 |
| InChIKey | DXRCGLMDNIZMKU-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|