C10H17F3N4 — CID 119111479
N-(1H-imidazol-2-ylmethyl)-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine (PubChem CID 119111479) has the molecular formula C10H17F3N4 and a molecular weight of 250.27 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 119111479 |
| Molecular Formula | C10H17F3N4 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine |
| SMILES | CN(CCCNCc1ncc[nH]1)CC(F)(F)F |
| InChI | InChI=1S/C10H17F3N4/c1-17(8-10(11,12)13)6-2-3-14-7-9-15-4-5-16-9/h4-5,14H,2-3,6-8H2,1H3,(H,15,16) |
| InChIKey | OBHAPBQPFUGXST-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|