C18H20F3N3O2 — CID 119111962
1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(2-prop-2-ynoxyphenyl)methylamino]butan-2-ol (PubChem CID 119111962) has the molecular formula C18H20F3N3O2 and a molecular weight of 367.37 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(2-prop-2-ynoxyphenyl)methylamino]butan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(2-prop-2-ynoxyphenyl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 119111962 |
| Molecular Formula | C18H20F3N3O2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1,1,1-trifluoro-2-(1-methylimidazol-2-yl)-4-[(2-prop-2-ynoxyphenyl)methylamino]butan-2-ol |
| SMILES | C#CCOc1ccccc1CNCCC(O)(c1nccn1C)C(F)(F)F |
| InChI | InChI=1S/C18H20F3N3O2/c1-3-12-26-15-7-5-4-6-14(15)13-22-9-8-17(25,18(19,20)21)16-23-10-11-24(16)2/h1,4-7,10-11,22,25H,8-9,12-13H2,2H3 |
| InChIKey | ZEPKVAAWYMTWCN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|