C19H22N4O — CID 119112037
3-[[1-(1-ethylbenzimidazol-2-yl)ethylamino]methyl]benzamide (PubChem CID 119112037) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-[[1-(1-ethylbenzimidazol-2-yl)ethylamino]methyl]benzamide.
| Compound Name | 3-[[1-(1-ethylbenzimidazol-2-yl)ethylamino]methyl]benzamide |
|---|---|
| PubChem CID | 119112037 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 3-[[1-(1-ethylbenzimidazol-2-yl)ethylamino]methyl]benzamide |
| SMILES | CCn1c(C(C)NCc2cccc(C(N)=O)c2)nc2ccccc21 |
| InChI | InChI=1S/C19H22N4O/c1-3-23-17-10-5-4-9-16(17)22-19(23)13(2)21-12-14-7-6-8-15(11-14)18(20)24/h4-11,13,21H,3,12H2,1-2H3,(H2,20,24) |
| InChIKey | AJPHKLCOHGHORU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |