C18H24N2O4S — CID 119112492
2-ethylsulfonyl-N-[[5-methoxy-2-(pyridin-2-ylmethoxy)phenyl]methyl]ethanamine (PubChem CID 119112492) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-ethylsulfonyl-N-[[5-methoxy-2-(pyridin-2-ylmethoxy)phenyl]methyl]ethanamine.
| Compound Name | 2-ethylsulfonyl-N-[[5-methoxy-2-(pyridin-2-ylmethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 119112492 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-ethylsulfonyl-N-[[5-methoxy-2-(pyridin-2-ylmethoxy)phenyl]methyl]ethanamine |
| SMILES | CCS(=O)(=O)CCNCc1cc(OC)ccc1OCc1ccccn1 |
| InChI | InChI=1S/C18H24N2O4S/c1-3-25(21,22)11-10-19-13-15-12-17(23-2)7-8-18(15)24-14-16-6-4-5-9-20-16/h4-9,12,19H,3,10-11,13-14H2,1-2H3 |
| InChIKey | KYLYOJSFHCWKIC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|