C13H16ClIN4S — CID 119112638
N-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 119112638) has the molecular formula C13H16ClIN4S and a molecular weight of 422.72 g/mol. Its IUPAC name is N-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 119112638 |
| Molecular Formula | C13H16ClIN4S |
| Molecular Weight | 422.72 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | N-[2-(5-chloro-1,3-benzothiazol-2-yl)ethyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | Clc1ccc2sc(CCNC3=NCCCN3)nc2c1.I |
| InChI | InChI=1S/C13H15ClN4S.HI/c14-9-2-3-11-10(8-9)18-12(19-11)4-7-17-13-15-5-1-6-16-13;/h2-3,8H,1,4-7H2,(H2,15,16,17);1H |
| InChIKey | PCMHSGKPHMQFGP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.72 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|