C21H20O4 — CID 11911315
(1R,2S,3S,6R)-1-methyl-3,6-diphenylcyclohex-4-ene-1,2-dicarboxylic acid (PubChem CID 11911315) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is (1R,2S,3S,6R)-1-methyl-3,6-diphenylcyclohex-4-ene-1,2-dicarboxylic acid.
| Compound Name | (1R,2S,3S,6R)-1-methyl-3,6-diphenylcyclohex-4-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 11911315 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (1R,2S,3S,6R)-1-methyl-3,6-diphenylcyclohex-4-ene-1,2-dicarboxylic acid |
| SMILES | C[C@@]1(C(=O)O)[C@@H](c2ccccc2)C=C[C@H](c2ccccc2)[C@@H]1C(=O)O |
| InChI | InChI=1S/C21H20O4/c1-21(20(24)25)17(15-10-6-3-7-11-15)13-12-16(18(21)19(22)23)14-8-4-2-5-9-14/h2-13,16-18H,1H3,(H,22,23)(H,24,25)/t16-,17-,18-,21-/m1/s1 |
| InChIKey | NOPCSNLZJFWADF-NEYJZJCJSA-N |
| XLogP | 3.92 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|