C17H18ClN3O3 — CID 119113534
(3S)-1-[1-(4-chlorophenyl)-5-methylpyrazole-4-carbonyl]piperidine-3-carboxylic acid (PubChem CID 119113534) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is (3S)-1-[1-(4-chlorophenyl)-5-methylpyrazole-4-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[1-(4-chlorophenyl)-5-methylpyrazole-4-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119113534 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (3S)-1-[1-(4-chlorophenyl)-5-methylpyrazole-4-carbonyl]piperidine-3-carboxylic acid |
| SMILES | Cc1c(C(=O)N2CCC[C@H](C(=O)O)C2)cnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClN3O3/c1-11-15(9-19-21(11)14-6-4-13(18)5-7-14)16(22)20-8-2-3-12(10-20)17(23)24/h4-7,9,12H,2-3,8,10H2,1H3,(H,23,24)/t12-/m0/s1 |
| InChIKey | RWVDDWHJFWYGKD-LBPRGKRZSA-N |
| XLogP | 2.77 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |