C19H22N4O2S — CID 119114186
N-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine (PubChem CID 119114186) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is N-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine.
| Compound Name | N-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 119114186 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]methyl]-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
| SMILES | Cc1nn(C)c(C)c1CCNCc1csc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C19H22N4O2S/c1-12-16(13(2)23(3)22-12)6-7-20-9-15-10-26-19(21-15)14-4-5-17-18(8-14)25-11-24-17/h4-5,8,10,20H,6-7,9,11H2,1-3H3 |
| InChIKey | UHIPYSWXGGPMSX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|