C14H20N3O2+ — CID 11911473
[(3aS,8bS)-3,4-dimethyl-2,3,3a,8b-tetrahydro-1H-pyrrolo[2,3-b]indol-3-ium-7-yl] N-methylcarbamate (PubChem CID 11911473) has the molecular formula C14H20N3O2+ and a molecular weight of 262.33 g/mol. Its IUPAC name is [(3aS,8bS)-3,4-dimethyl-2,3,3a,8b-tetrahydro-1H-pyrrolo[2,3-b]indol-3-ium-7-yl] N-methylcarbamate.
| Compound Name | [(3aS,8bS)-3,4-dimethyl-2,3,3a,8b-tetrahydro-1H-pyrrolo[2,3-b]indol-3-ium-7-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 11911473 |
| Molecular Formula | C14H20N3O2+ |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | [(3aS,8bS)-3,4-dimethyl-2,3,3a,8b-tetrahydro-1H-pyrrolo[2,3-b]indol-3-ium-7-yl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccc2c(c1)[C@@H]1CC[NH+](C)[C@@H]1N2C |
| InChI | InChI=1S/C14H19N3O2/c1-15-14(18)19-9-4-5-12-11(8-9)10-6-7-16(2)13(10)17(12)3/h4-5,8,10,13H,6-7H2,1-3H3,(H,15,18)/p+1/t10-,13+/m0/s1 |
| InChIKey | KFIIABIGRKUSOL-GXFFZTMASA-O |
| XLogP | 0.18 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |