C17H29F3N4O — CID 119114796
N-[[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]methyl]-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 119114796) has the molecular formula C17H29F3N4O and a molecular weight of 362.44 g/mol. Its IUPAC name is N-[[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]methyl]-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | N-[[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]methyl]-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 119114796 |
| Molecular Formula | C17H29F3N4O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | N-[[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]methyl]-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | Cc1nn(C)c(OCC(F)(F)F)c1CNC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C17H29F3N4O/c1-11-13(14(24(6)22-11)25-10-17(18,19)20)9-21-12-7-15(2,3)23-16(4,5)8-12/h12,21,23H,7-10H2,1-6H3 |
| InChIKey | ZRXWFZXRSIAJCJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |