C25H25N7O6 — CID 11911512
1-[(6aS,8S)-2-(2,4-dimethoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]triazole-4,5-dicarboxamide (PubChem CID 11911512) has the molecular formula C25H25N7O6 and a molecular weight of 519.52 g/mol. Its IUPAC name is 1-[(6aS,8S)-2-(2,4-dimethoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]triazole-4,5-dicarboxamide.
| Compound Name | 1-[(6aS,8S)-2-(2,4-dimethoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]triazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 11911512 |
| Molecular Formula | C25H25N7O6 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 1-[(6aS,8S)-2-(2,4-dimethoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]triazole-4,5-dicarboxamide |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)N2CC[C@H](n4nnc(C(N)=O)c4C(N)=O)C[C@H]2C(=O)N3)c(OC)c1 |
| InChI | InChI=1S/C25H25N7O6/c1-37-14-4-5-15(19(11-14)38-2)12-3-6-17-16(9-12)25(36)31-8-7-13(10-18(31)24(35)28-17)32-21(23(27)34)20(22(26)33)29-30-32/h3-6,9,11,13,18H,7-8,10H2,1-2H3,(H2,26,33)(H2,27,34)(H,28,35)/t13-,18-/m0/s1 |
| InChIKey | CNHWSUVVFDDOFF-UGSOOPFHSA-N |
| XLogP | 0.96 |
| TPSA | 184.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |