About 5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile
5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile (PubChem CID 119115265) has the molecular formula C20H25N3O
and a molecular weight of 323.44 g/mol. Its IUPAC name is 5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile.
Molecular Properties
| Compound Name | 5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile |
| PubChem CID | 119115265 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile |
| SMILES | Cc1cc(CNCCCCC#N)cc(C)c1OCc1ccccn1 |
| InChI | InChI=1S/C20H25N3O/c1-16-12-18(14-22-10-6-3-5-9-21)13-17(2)20(16)24-15-19-8-4-7-11-23-19/h4,7-8,11-13,22H,3,5-6,10,14-15H2,1-2H3 |
| InChIKey | SBLKFHBZAWWHAF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile?
The IUPAC name of 5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile (CID 119115265) is 5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile.
What is the SMILES notation for 5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile?
The canonical SMILES for 5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile is Cc1cc(CNCCCCC#N)cc(C)c1OCc1ccccn1.
What is the InChIKey of 5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile?
The InChIKey is SBLKFHBZAWWHAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O/c1-16-12-18(14-22-10-6-3-5-9-21)13-17(2)20(16)24-15-19-8-4-7-11-23-19/h4,7-8,11-13,22H,3,5-6,10,14-15H2,1-2H3.
What are the key properties of 5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile?
5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile has a molecular weight of 323.44 g/mol, XLogP of 4.06, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3,5-dimethyl-4-(pyridin-2-ylmethoxy)phenyl]methylamino]pentanenitrile is sourced from PubChem (CID 119115265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).