About 5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile
5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile (PubChem CID 119115319) has the molecular formula C13H20N4OS
and a molecular weight of 280.40 g/mol. Its IUPAC name is 5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile.
Molecular Properties
| Compound Name | 5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile |
| PubChem CID | 119115319 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile |
| SMILES | N#CCCCCNCc1cnc(N2CCOCC2)s1 |
| InChI | InChI=1S/C13H20N4OS/c14-4-2-1-3-5-15-10-12-11-16-13(19-12)17-6-8-18-9-7-17/h11,15H,1-3,5-10H2 |
| InChIKey | QJGYBNHBQRGQKZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile?
The IUPAC name of 5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile (CID 119115319) is 5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile.
What is the SMILES notation for 5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile?
The canonical SMILES for 5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile is N#CCCCCNCc1cnc(N2CCOCC2)s1.
What is the InChIKey of 5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile?
The InChIKey is QJGYBNHBQRGQKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4OS/c14-4-2-1-3-5-15-10-12-11-16-13(19-12)17-6-8-18-9-7-17/h11,15H,1-3,5-10H2.
What are the key properties of 5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile?
5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile has a molecular weight of 280.40 g/mol, XLogP of 1.76, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-morpholin-4-yl-1,3-thiazol-5-yl)methylamino]pentanenitrile is sourced from PubChem (CID 119115319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).