C13H19F3N4O — CID 119115322
5-[[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]methylamino]pentanenitrile (PubChem CID 119115322) has the molecular formula C13H19F3N4O and a molecular weight of 304.32 g/mol. Its IUPAC name is 5-[[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]methylamino]pentanenitrile.
| Compound Name | 5-[[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]methylamino]pentanenitrile |
|---|---|
| PubChem CID | 119115322 |
| Molecular Formula | C13H19F3N4O |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 5-[[1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazol-4-yl]methylamino]pentanenitrile |
| SMILES | Cc1nn(C)c(OCC(F)(F)F)c1CNCCCCC#N |
| InChI | InChI=1S/C13H19F3N4O/c1-10-11(8-18-7-5-3-4-6-17)12(20(2)19-10)21-9-13(14,15)16/h18H,3-5,7-9H2,1-2H3 |
| InChIKey | KXBBLJBFPMVZOK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|