C18H23NO6 — CID 11911594
methyl 4-[[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-4-oxobutanoate (PubChem CID 11911594) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is methyl 4-[[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-4-oxobutanoate.
| Compound Name | methyl 4-[[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 11911594 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | methyl 4-[[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C18H23NO6/c1-22-16(21)8-7-15(20)19-13-10-24-18-14(11-25-17(13)18)23-9-12-5-3-2-4-6-12/h2-6,13-14,17-18H,7-11H2,1H3,(H,19,20)/t13-,14+,17+,18+/m0/s1 |
| InChIKey | LCBUVPXZFYGAQK-MJSCVDMRSA-N |
| XLogP | 0.81 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |