C15H21IN6 — CID 119116299
2-methyl-1-[[2-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-prop-2-enylguanidine;hydroiodide (PubChem CID 119116299) has the molecular formula C15H21IN6 and a molecular weight of 412.28 g/mol. Its IUPAC name is 2-methyl-1-[[2-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119116299 |
| Molecular Formula | C15H21IN6 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 2-methyl-1-[[2-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\C)NCc1cccnc1-n1ccnc1C.I |
| InChI | InChI=1S/C15H20N6.HI/c1-4-7-19-15(16-3)20-11-13-6-5-8-18-14(13)21-10-9-17-12(21)2;/h4-6,8-10H,1,7,11H2,2-3H3,(H2,16,19,20);1H |
| InChIKey | GYRQLEYLOMOIOP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|