C16H24IN5S2 — CID 119116905
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 119116905) has the molecular formula C16H24IN5S2 and a molecular weight of 477.44 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119116905 |
| Molecular Formula | C16H24IN5S2 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CCc2sccc2C1)NCc1nc(C)cs1.I |
| InChI | InChI=1S/C16H23N5S2.HI/c1-12-11-23-15(20-12)9-19-16(17-2)18-5-7-21-6-3-14-13(10-21)4-8-22-14;/h4,8,11H,3,5-7,9-10H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | QPEWEFPLBBYMAW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|