C13H22IN5OS — CID 119116997
2-[[(cyclopropylamino)-[(4-methyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 119116997) has the molecular formula C13H22IN5OS and a molecular weight of 423.32 g/mol. Its IUPAC name is 2-[[(cyclopropylamino)-[(4-methyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(cyclopropylamino)-[(4-methyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 119116997 |
| Molecular Formula | C13H22IN5OS |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 2-[[(cyclopropylamino)-[(4-methyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | Cc1csc(CN/C(=N\CC(=O)N(C)C)NC2CC2)n1.I |
| InChI | InChI=1S/C13H21N5OS.HI/c1-9-8-20-11(16-9)6-14-13(17-10-4-5-10)15-7-12(19)18(2)3;/h8,10H,4-7H2,1-3H3,(H2,14,15,17);1H |
| InChIKey | VSJAZDXMGUEMLN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|