C18H21FIN3O3 — CID 119117214
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-fluorophenoxy)ethyl]guanidine;hydroiodide (PubChem CID 119117214) has the molecular formula C18H21FIN3O3 and a molecular weight of 473.29 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-fluorophenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-fluorophenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119117214 |
| Molecular Formula | C18H21FIN3O3 |
| Molecular Weight | 473.29 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(2-fluorophenoxy)ethyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCOc1ccccc1F)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C18H20FN3O3.HI/c19-14-4-1-2-5-15(14)25-11-8-21-18(20)22-13-6-7-16-17(12-13)24-10-3-9-23-16;/h1-2,4-7,12H,3,8-11H2,(H3,20,21,22);1H |
| InChIKey | AKODPNPWPDTNBL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|