C18H23N5O — CID 119117265
2-[(4-benzylmorpholin-2-yl)methyl]-1-pyridin-2-ylguanidine (PubChem CID 119117265) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-[(4-benzylmorpholin-2-yl)methyl]-1-pyridin-2-ylguanidine.
| Compound Name | 2-[(4-benzylmorpholin-2-yl)methyl]-1-pyridin-2-ylguanidine |
|---|---|
| PubChem CID | 119117265 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-[(4-benzylmorpholin-2-yl)methyl]-1-pyridin-2-ylguanidine |
| SMILES | N/C(=N\CC1CN(Cc2ccccc2)CCO1)Nc1ccccn1 |
| InChI | InChI=1S/C18H23N5O/c19-18(22-17-8-4-5-9-20-17)21-12-16-14-23(10-11-24-16)13-15-6-2-1-3-7-15/h1-9,16H,10-14H2,(H3,19,20,21,22) |
| InChIKey | IBBPONPIRJGNIQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|