C19H23N9 — CID 119117802
4-pyrimidin-2-yl-N'-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide (PubChem CID 119117802) has the molecular formula C19H23N9 and a molecular weight of 377.46 g/mol. Its IUPAC name is 4-pyrimidin-2-yl-N'-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-pyrimidin-2-yl-N'-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119117802 |
| Molecular Formula | C19H23N9 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 4-pyrimidin-2-yl-N'-[[4-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccc(Cn2cncn2)cc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H23N9/c20-18(26-8-10-27(11-9-26)19-22-6-1-7-23-19)24-12-16-2-4-17(5-3-16)13-28-15-21-14-25-28/h1-7,14-15H,8-13H2,(H2,20,24) |
| InChIKey | QKLAAVAHJLOOHG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|