C15H18N4O5 — CID 11911799
methyl 1-[(3S,3aR,6S,6aR)-3-(furan-2-ylmethylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate (PubChem CID 11911799) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is methyl 1-[(3S,3aR,6S,6aR)-3-(furan-2-ylmethylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(3S,3aR,6S,6aR)-3-(furan-2-ylmethylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 11911799 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | methyl 1-[(3S,3aR,6S,6aR)-3-(furan-2-ylmethylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn([C@H]2CO[C@H]3[C@@H]2OC[C@@H]3NCc2ccco2)nn1 |
| InChI | InChI=1S/C15H18N4O5/c1-21-15(20)10-6-19(18-17-10)12-8-24-13-11(7-23-14(12)13)16-5-9-3-2-4-22-9/h2-4,6,11-14,16H,5,7-8H2,1H3/t11-,12-,13+,14+/m0/s1 |
| InChIKey | QDDRYVRJPLCYKV-IGQOVBAYSA-N |
| XLogP | 0.15 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |