C25H29N5O4 — CID 11911807
N-[(3S,3aR,6S,6aR)-6-[4-[[benzyl(methyl)amino]methyl]triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide (PubChem CID 11911807) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-6-[4-[[benzyl(methyl)amino]methyl]triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-6-[4-[[benzyl(methyl)amino]methyl]triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 11911807 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-6-[4-[[benzyl(methyl)amino]methyl]triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H]2CO[C@H]3[C@@H]2OC[C@@H]3n2cc(CN(C)Cc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C25H29N5O4/c1-29(12-17-6-4-3-5-7-17)13-19-14-30(28-27-19)22-16-34-23-21(15-33-24(22)23)26-25(31)18-8-10-20(32-2)11-9-18/h3-11,14,21-24H,12-13,15-16H2,1-2H3,(H,26,31)/t21-,22-,23+,24+/m0/s1 |
| InChIKey | UKAUGMQANYMWLM-CJRSTVEYSA-N |
| XLogP | 2.06 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |