About N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide
N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 119118139) has the molecular formula C9H17F3IN3O2
and a molecular weight of 383.15 g/mol. Its IUPAC name is N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide.
Molecular Properties
| Compound Name | N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide |
| PubChem CID | 119118139 |
| Molecular Formula | C9H17F3IN3O2 |
| Molecular Weight | 383.15 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCOCC(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/C9H16F3N3O2.HI/c10-9(11,12)7-17-4-1-14-8(13)15-2-5-16-6-3-15;/h1-7H2,(H2,13,14);1H |
| InChIKey | VXUIDGBAAWJFLP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.15 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide?
The IUPAC name of N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide (CID 119118139) is N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide.
What is the SMILES notation for N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide?
The canonical SMILES for N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide is I.N/C(=N\CCOCC(F)(F)F)N1CCOCC1.
What is the InChIKey of N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide?
The InChIKey is VXUIDGBAAWJFLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3N3O2.HI/c10-9(11,12)7-17-4-1-14-8(13)15-2-5-16-6-3-15;/h1-7H2,(H2,13,14);1H.
What are the key properties of N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide?
N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide has a molecular weight of 383.15 g/mol, XLogP of 0.83, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2,2,2-trifluoroethoxy)ethyl]morpholine-4-carboximidamide;hydroiodide is sourced from PubChem (CID 119118139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).