C22H36N4O2 — CID 11911952
(3S,3aR,6S,6aR)-N-(cyclohexylmethyl)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine (PubChem CID 11911952) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is (3S,3aR,6S,6aR)-N-(cyclohexylmethyl)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine.
| Compound Name | (3S,3aR,6S,6aR)-N-(cyclohexylmethyl)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine |
|---|---|
| PubChem CID | 11911952 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (3S,3aR,6S,6aR)-N-(cyclohexylmethyl)-6-[4-(cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine |
| SMILES | c1c(CC2CCCCC2)nnn1[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2NCC1CCCCC1 |
| InChI | InChI=1S/C22H36N4O2/c1-3-7-16(8-4-1)11-18-13-26(25-24-18)20-15-28-21-19(14-27-22(20)21)23-12-17-9-5-2-6-10-17/h13,16-17,19-23H,1-12,14-15H2/t19-,20-,21+,22+/m0/s1 |
| InChIKey | PBQZLEWGGAEQNU-FNAHDJPLSA-N |
| XLogP | 3.28 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |