About 2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide
2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 11911991) has the molecular formula C17H31N3O4
and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide |
| PubChem CID | 11911991 |
| Molecular Formula | C17H31N3O4 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | 2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CC[C@H]1CN(C(=O)N2CCOCC2)CC[C@H]1CC(=O)NCCOC |
| InChI | InChI=1S/C17H31N3O4/c1-3-14-13-20(17(22)19-7-10-24-11-8-19)6-4-15(14)12-16(21)18-5-9-23-2/h14-15H,3-13H2,1-2H3,(H,18,21)/t14-,15-/m0/s1 |
| InChIKey | MOOYIUPTPXKOLE-GJZGRUSLSA-N |
| XLogP | 0.94 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide?
The IUPAC name of 2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide (CID 11911991) is 2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide.
What is the SMILES notation for 2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide?
The canonical SMILES for 2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide is CC[C@H]1CN(C(=O)N2CCOCC2)CC[C@H]1CC(=O)NCCOC.
What is the InChIKey of 2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide?
The InChIKey is MOOYIUPTPXKOLE-GJZGRUSLSA-N. The full InChI is InChI=1S/C17H31N3O4/c1-3-14-13-20(17(22)19-7-10-24-11-8-19)6-4-15(14)12-16(21)18-5-9-23-2/h14-15H,3-13H2,1-2H3,(H,18,21)/t14-,15-/m0/s1.
What are the key properties of 2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide?
2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide has a molecular weight of 341.45 g/mol, XLogP of 0.94, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-3-ethyl-1-(morpholine-4-carbonyl)piperidin-4-yl]-N-(2-methoxyethyl)acetamide is sourced from PubChem (CID 11911991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).