About 2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide
2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide (PubChem CID 11911992) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide |
| PubChem CID | 11911992 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide |
| SMILES | CC[C@H]1CN(C(C)=O)CC[C@H]1CC(=O)NC(C)C |
| InChI | InChI=1S/C14H26N2O2/c1-5-12-9-16(11(4)17)7-6-13(12)8-14(18)15-10(2)3/h10,12-13H,5-9H2,1-4H3,(H,15,18)/t12-,13-/m0/s1 |
| InChIKey | WNJQARPUTPTNON-STQMWFEESA-N |
| XLogP | 1.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide?
The IUPAC name of 2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide (CID 11911992) is 2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide.
What is the SMILES notation for 2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide?
The canonical SMILES for 2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide is CC[C@H]1CN(C(C)=O)CC[C@H]1CC(=O)NC(C)C.
What is the InChIKey of 2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide?
The InChIKey is WNJQARPUTPTNON-STQMWFEESA-N. The full InChI is InChI=1S/C14H26N2O2/c1-5-12-9-16(11(4)17)7-6-13(12)8-14(18)15-10(2)3/h10,12-13H,5-9H2,1-4H3,(H,15,18)/t12-,13-/m0/s1.
What are the key properties of 2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide?
2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide has a molecular weight of 254.37 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-1-acetyl-3-ethylpiperidin-4-yl]-N-propan-2-ylacetamide is sourced from PubChem (CID 11911992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).