C13H26N4O3S — CID 119120963
2-[(1-methylsulfonylpiperidin-4-yl)methyl]-1-(oxolan-2-ylmethyl)guanidine (PubChem CID 119120963) has the molecular formula C13H26N4O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is 2-[(1-methylsulfonylpiperidin-4-yl)methyl]-1-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 2-[(1-methylsulfonylpiperidin-4-yl)methyl]-1-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119120963 |
| Molecular Formula | C13H26N4O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[(1-methylsulfonylpiperidin-4-yl)methyl]-1-(oxolan-2-ylmethyl)guanidine |
| SMILES | CS(=O)(=O)N1CCC(C/N=C(\N)NCC2CCCO2)CC1 |
| InChI | InChI=1S/C13H26N4O3S/c1-21(18,19)17-6-4-11(5-7-17)9-15-13(14)16-10-12-3-2-8-20-12/h11-12H,2-10H2,1H3,(H3,14,15,16) |
| InChIKey | ABXHDJADJCAGNC-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|